C26H21ClN6O3 — CID 161081509
2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-indole-6-carboxylic acid (PubChem CID 161081509) has the molecular formula C26H21ClN6O3 and a molecular weight of 500.95 g/mol. Its IUPAC name is 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-indole-6-carboxylic acid.
| Compound Name | 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 161081509 |
| Molecular Formula | C26H21ClN6O3 |
| Molecular Weight | 500.95 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)N=C(C(CC1CC1)c1ccc(-c3cc(Cl)ccc3-n3cnnn3)c[n+]1[O-])C2 |
| InChI | InChI=1S/C26H21ClN6O3/c27-19-6-8-24(32-14-28-30-31-32)20(12-19)18-5-7-25(33(36)13-18)21(9-15-1-2-15)23-10-16-3-4-17(26(34)35)11-22(16)29-23/h3-8,11-15,21H,1-2,9-10H2,(H,34,35) |
| InChIKey | GHKUOVUKKBYVNM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|