C34H33ClN6O3 — CID 138469398
1-[4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 138469398) has the molecular formula C34H33ClN6O3 and a molecular weight of 609.13 g/mol. Its IUPAC name is 1-[4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 138469398 |
| Molecular Formula | C34H33ClN6O3 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 1-[4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(c2cccc([C@H](Cc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])c2)CC1 |
| InChI | InChI=1S/C34H33ClN6O3/c1-44-22-34(42)39-16-14-25(15-17-39)26-8-5-9-27(19-26)30(18-24-6-3-2-4-7-24)33-12-10-28(21-41(33)43)31-20-29(35)11-13-32(31)40-23-36-37-38-40/h2-13,19-21,23,25,30H,14-18,22H2,1H3/t30-/m0/s1 |
| InChIKey | SUJBYUKAGSKNOT-PMERELPUSA-N |
| XLogP | 5.34 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|