C37H38ClN7O3 — CID 138469387
4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]-N-(oxolan-3-ylmethyl)piperidine-1-carboxamide (PubChem CID 138469387) has the molecular formula C37H38ClN7O3 and a molecular weight of 664.21 g/mol. Its IUPAC name is 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]-N-(oxolan-3-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]-N-(oxolan-3-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 138469387 |
| Molecular Formula | C37H38ClN7O3 |
| Molecular Weight | 664.21 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]-N-(oxolan-3-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC1CCOC1)N1CCC(c2cccc(C(Cc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])c2)CC1 |
| InChI | InChI=1S/C37H38ClN7O3/c38-32-10-12-35(44-25-40-41-42-44)34(21-32)31-9-11-36(45(47)23-31)33(19-26-5-2-1-3-6-26)30-8-4-7-29(20-30)28-13-16-43(17-14-28)37(46)39-22-27-15-18-48-24-27/h1-12,20-21,23,25,27-28,33H,13-19,22,24H2,(H,39,46) |
| InChIKey | AWFWGPTVUBFPHC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.21 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|