C36H37ClN6O3 — CID 118860202
tert-butyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate (PubChem CID 118860202) has the molecular formula C36H37ClN6O3 and a molecular weight of 637.18 g/mol. Its IUPAC name is tert-butyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118860202 |
| Molecular Formula | C36H37ClN6O3 |
| Molecular Weight | 637.18 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | tert-butyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc([C@H](Cc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])c2)CC1 |
| InChI | InChI=1S/C36H37ClN6O3/c1-36(2,3)46-35(44)41-18-16-26(17-19-41)27-10-7-11-28(21-27)31(20-25-8-5-4-6-9-25)34-14-12-29(23-43(34)45)32-22-30(37)13-15-33(32)42-24-38-39-40-42/h4-15,21-24,26,31H,16-20H2,1-3H3/t31-/m0/s1 |
| InChIKey | ZOMGXNJRRRRLMU-HKBQPEDESA-N |
| XLogP | 7.11 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.18 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|