C31H25ClN7O3+ — CID 118859615
4-[2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-methoxypyridin-1-ium-2-yl]-2-phenylethyl]-1H-imidazol-5-yl]benzoic acid (PubChem CID 118859615) has the molecular formula C31H25ClN7O3+ and a molecular weight of 579.04 g/mol. Its IUPAC name is 4-[2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-methoxypyridin-1-ium-2-yl]-2-phenylethyl]-1H-imidazol-5-yl]benzoic acid.
| Compound Name | 4-[2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-methoxypyridin-1-ium-2-yl]-2-phenylethyl]-1H-imidazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 118859615 |
| Molecular Formula | C31H25ClN7O3+ |
| Molecular Weight | 579.04 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 4-[2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-methoxypyridin-1-ium-2-yl]-2-phenylethyl]-1H-imidazol-5-yl]benzoic acid |
| SMILES | CO[n+]1cc(-c2cc(Cl)ccc2-n2cnnn2)ccc1C(Cc1ccccc1)c1ncc(-c2ccc(C(=O)O)cc2)[nH]1 |
| InChI | InChI=1S/C31H24ClN7O3/c1-42-39-18-23(25-16-24(32)12-14-28(25)38-19-34-36-37-38)11-13-29(39)26(15-20-5-3-2-4-6-20)30-33-17-27(35-30)21-7-9-22(10-8-21)31(40)41/h2-14,16-19,26H,15H2,1H3,(H-,33,35,40,41)/p+1 |
| InChIKey | YQCVYYAICUIRJO-UHFFFAOYSA-O |
| XLogP | 4.79 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|