C32H33ClN6O4 — CID 161180068
methyl 2-[4-[[2-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropanoyl]amino]-1-bicyclo[2.2.2]octanyl]acetate (PubChem CID 161180068) has the molecular formula C32H33ClN6O4 and a molecular weight of 601.11 g/mol. Its IUPAC name is methyl 2-[4-[[2-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropanoyl]amino]-1-bicyclo[2.2.2]octanyl]acetate.
| Compound Name | methyl 2-[4-[[2-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropanoyl]amino]-1-bicyclo[2.2.2]octanyl]acetate |
|---|---|
| PubChem CID | 161180068 |
| Molecular Formula | C32H33ClN6O4 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | methyl 2-[4-[[2-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropanoyl]amino]-1-bicyclo[2.2.2]octanyl]acetate |
| SMILES | COC(=O)CC12CCC(NC(=O)C(Cc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])(CC1)CC2 |
| InChI | InChI=1S/C32H33ClN6O4/c1-43-29(40)19-31-11-14-32(15-12-31,16-13-31)35-30(41)26(17-22-5-3-2-4-6-22)28-9-7-23(20-39(28)42)25-18-24(33)8-10-27(25)38-21-34-36-37-38/h2-10,18,20-21,26H,11-17,19H2,1H3,(H,35,41) |
| InChIKey | AIKFZKJUSPAWAX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|