C27H19ClFN7O — CID 118694131
2-[(1R)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]-6-fluoro-1H-benzimidazole (PubChem CID 118694131) has the molecular formula C27H19ClFN7O and a molecular weight of 511.95 g/mol. Its IUPAC name is 2-[(1R)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]-6-fluoro-1H-benzimidazole.
| Compound Name | 2-[(1R)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]-6-fluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 118694131 |
| Molecular Formula | C27H19ClFN7O |
| Molecular Weight | 511.95 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 2-[(1R)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]-6-fluoro-1H-benzimidazole |
| SMILES | [O-][n+]1cc(-c2cc(Cl)ccc2-n2cnnn2)ccc1[C@@H](Cc1ccccc1)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C27H19ClFN7O/c28-19-7-11-25(35-16-30-33-34-35)21(13-19)18-6-10-26(36(37)15-18)22(12-17-4-2-1-3-5-17)27-31-23-9-8-20(29)14-24(23)32-27/h1-11,13-16,22H,12H2,(H,31,32)/t22-/m1/s1 |
| InChIKey | FJFWWRKZQPPWJU-JOCHJYFZSA-N |
| XLogP | 5.01 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|