C22H15ClFN7O2 — CID 122624036
3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(6-fluoro-1H-benzimidazol-2-yl)-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 122624036) has the molecular formula C22H15ClFN7O2 and a molecular weight of 463.86 g/mol. Its IUPAC name is 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(6-fluoro-1H-benzimidazol-2-yl)-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(6-fluoro-1H-benzimidazol-2-yl)-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 122624036 |
| Molecular Formula | C22H15ClFN7O2 |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(6-fluoro-1H-benzimidazol-2-yl)-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | [O-][n+]1cc(-c2cc(Cl)ccc2-n2cnnn2)cc2c1C(O)(c1nc3ccc(F)cc3[nH]1)CC2 |
| InChI | InChI=1S/C22H15ClFN7O2/c23-14-1-4-19(30-11-25-28-29-30)16(8-14)13-7-12-5-6-22(32,20(12)31(33)10-13)21-26-17-3-2-15(24)9-18(17)27-21/h1-4,7-11,32H,5-6H2,(H,26,27) |
| InChIKey | KAKXNUAPRSTTPU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|