C23H19ClN9O2+ — CID 122632675
7-[5-(6-amino-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 122632675) has the molecular formula C23H19ClN9O2+ and a molecular weight of 488.92 g/mol. Its IUPAC name is 7-[5-(6-amino-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 7-[5-(6-amino-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 122632675 |
| Molecular Formula | C23H19ClN9O2+ |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 7-[5-(6-amino-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | Nc1ccc(-c2cnc(C3(O)CCc4cc(-c5cc(Cl)ccc5-n5cnnn5)c[n+](O)c43)[nH]2)cn1 |
| InChI | InChI=1S/C23H19ClN9O2/c24-16-2-3-19(32-12-28-30-31-32)17(8-16)15-7-13-5-6-23(34,21(13)33(35)11-15)22-27-10-18(29-22)14-1-4-20(25)26-9-14/h1-4,7-12,34-35H,5-6H2,(H2,25,26)(H,27,29)/q+1 |
| InChIKey | HYEGJROLEZUMEQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|