C23H17Cl2F2N5O2 — CID 122623953
7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(difluoromethyl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 122623953) has the molecular formula C23H17Cl2F2N5O2 and a molecular weight of 504.32 g/mol. Its IUPAC name is 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(difluoromethyl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(difluoromethyl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 122623953 |
| Molecular Formula | C23H17Cl2F2N5O2 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(difluoromethyl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | Nc1ccc(-c2cnc(C3(O)CCc4cc(-c5cc(Cl)ccc5C(F)F)c[n+]([O-])c43)[nH]2)c(Cl)n1 |
| InChI | InChI=1S/C23H17Cl2F2N5O2/c24-13-1-2-14(21(26)27)16(8-13)12-7-11-5-6-23(33,19(11)32(34)10-12)22-29-9-17(30-22)15-3-4-18(28)31-20(15)25/h1-4,7-10,21,33H,5-6H2,(H2,28,31)(H,29,30) |
| InChIKey | VWYMEDHYDORKIT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|