C22H18ClFN4O3S — CID 122632711
3-(2-amino-5-chlorophenyl)-7-[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 122632711) has the molecular formula C22H18ClFN4O3S and a molecular weight of 472.93 g/mol. Its IUPAC name is 3-(2-amino-5-chlorophenyl)-7-[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 3-(2-amino-5-chlorophenyl)-7-[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 122632711 |
| Molecular Formula | C22H18ClFN4O3S |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 3-(2-amino-5-chlorophenyl)-7-[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | Nc1ccc(Cl)cc1-c1cc2c([n+]([O-])c1)C(O)(c1ncc(-c3csc(CO)c3F)[nH]1)CC2 |
| InChI | InChI=1S/C22H18ClFN4O3S/c23-13-1-2-16(25)14(6-13)12-5-11-3-4-22(30,20(11)28(31)8-12)21-26-7-17(27-21)15-10-32-18(9-29)19(15)24/h1-2,5-8,10,29-30H,3-4,9,25H2,(H,26,27) |
| InChIKey | HTNYMGQUGHZYDL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|