C23H17ClFN6O2+ — CID 159759304
3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(5-fluoro-3H-indol-2-yl)-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 159759304) has the molecular formula C23H17ClFN6O2+ and a molecular weight of 463.88 g/mol. Its IUPAC name is 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(5-fluoro-3H-indol-2-yl)-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(5-fluoro-3H-indol-2-yl)-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 159759304 |
| Molecular Formula | C23H17ClFN6O2+ |
| Molecular Weight | 463.88 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-(5-fluoro-3H-indol-2-yl)-1-hydroxy-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | O[n+]1cc(-c2cc(Cl)ccc2-n2cnnn2)cc2c1C(O)(C1=Nc3ccc(F)cc3C1)CC2 |
| InChI | InChI=1S/C23H17ClFN6O2/c24-16-1-4-20(30-12-26-28-29-30)18(10-16)15-7-13-5-6-23(32,22(13)31(33)11-15)21-9-14-8-17(25)2-3-19(14)27-21/h1-4,7-8,10-12,32-33H,5-6,9H2/q+1 |
| InChIKey | NERCWHHLLXKDPE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|