C26H23ClN6O — CID 159466265
2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-5-methyl-3H-indole (PubChem CID 159466265) has the molecular formula C26H23ClN6O and a molecular weight of 470.96 g/mol. Its IUPAC name is 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-5-methyl-3H-indole.
| Compound Name | 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-5-methyl-3H-indole |
|---|---|
| PubChem CID | 159466265 |
| Molecular Formula | C26H23ClN6O |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-5-methyl-3H-indole |
| SMILES | Cc1ccc2c(c1)CC(C(CC1CC1)c1ccc(-c3cc(Cl)ccc3-n3cnnn3)c[n+]1[O-])=N2 |
| InChI | InChI=1S/C26H23ClN6O/c1-16-2-7-23-19(10-16)12-24(29-23)22(11-17-3-4-17)26-8-5-18(14-33(26)34)21-13-20(27)6-9-25(21)32-15-28-30-31-32/h2,5-10,13-15,17,22H,3-4,11-12H2,1H3 |
| InChIKey | NKHXTDSMIXRYRH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|