C29H26ClN4O4+ — CID 118548601
4-[[2-[5-(5-chloro-2-pyrazin-2-ylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid (PubChem CID 118548601) has the molecular formula C29H26ClN4O4+ and a molecular weight of 530.00 g/mol. Its IUPAC name is 4-[[2-[5-(5-chloro-2-pyrazin-2-ylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-(5-chloro-2-pyrazin-2-ylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 118548601 |
| Molecular Formula | C29H26ClN4O4+ |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 4-[[2-[5-(5-chloro-2-pyrazin-2-ylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
| SMILES | CO[n+]1cc(-c2cc(Cl)ccc2-c2cnccn2)ccc1C(CC1CC1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H25ClN4O4/c1-38-34-17-20(24-15-21(30)7-10-23(24)26-16-31-12-13-32-26)6-11-27(34)25(14-18-2-3-18)28(35)33-22-8-4-19(5-9-22)29(36)37/h4-13,15-18,25H,2-3,14H2,1H3,(H-,33,35,36,37)/p+1 |
| InChIKey | DRNXLHQMGUULGL-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|