C26H26ClN3O4 — CID 118548595
4-[[2-[5-[2-(aminomethyl)-5-chlorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid (PubChem CID 118548595) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 4-[[2-[5-[2-(aminomethyl)-5-chlorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid.
| Compound Name | 4-[[2-[5-[2-(aminomethyl)-5-chlorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 118548595 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-[[2-[5-[2-(aminomethyl)-5-chlorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid |
| SMILES | Cc1cc(NC(=O)C(CC2CC2)c2ccc(-c3cc(Cl)ccc3CN)c[n+]2[O-])ccc1C(=O)O |
| InChI | InChI=1S/C26H26ClN3O4/c1-15-10-20(7-8-21(15)26(32)33)29-25(31)23(11-16-2-3-16)24-9-5-18(14-30(24)34)22-12-19(27)6-4-17(22)13-28/h4-10,12,14,16,23H,2-3,11,13,28H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | QSZKXVHBSZWLCV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|