C26H20ClF4NO5 — CID 159361024
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxobutyl]-2-fluorobenzoic acid (PubChem CID 159361024) has the molecular formula C26H20ClF4NO5 and a molecular weight of 537.89 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxobutyl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxobutyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 159361024 |
| Molecular Formula | C26H20ClF4NO5 |
| Molecular Weight | 537.89 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxobutyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)C(CC2CC2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1F |
| InChI | InChI=1S/C26H20ClF4NO5/c27-18-6-8-22(37-26(30)31)23(24(18)29)15-4-7-20(32(36)12-15)17(9-13-1-2-13)21(33)11-14-3-5-16(25(34)35)19(28)10-14/h3-8,10,12-13,17,26H,1-2,9,11H2,(H,34,35) |
| InChIKey | LINRUKLAKKZXMF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.89 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|