C28H22ClF6NO4 — CID 162163672
3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-[2-(trifluoromethyl)cyclopropyl]butan-2-one (PubChem CID 162163672) has the molecular formula C28H22ClF6NO4 and a molecular weight of 585.93 g/mol. Its IUPAC name is 3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-[2-(trifluoromethyl)cyclopropyl]butan-2-one.
| Compound Name | 3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-[2-(trifluoromethyl)cyclopropyl]butan-2-one |
|---|---|
| PubChem CID | 162163672 |
| Molecular Formula | C28H22ClF6NO4 |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-[2-(trifluoromethyl)cyclopropyl]butan-2-one |
| SMILES | C=C(O)c1ccc(CC(=O)C(CC2CC2C(F)(F)F)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C28H22ClF6NO4/c1-14(37)16-4-2-15(3-5-16)10-23(38)19(11-18-12-20(18)28(33,34)35)22-8-6-17(13-36(22)39)25-24(40-27(31)32)9-7-21(29)26(25)30/h2-9,13,18-20,27,37H,1,10-12H2 |
| InChIKey | YBXGIVSZRYKHHK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|