C29H25ClF5NO5 — CID 160903604
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4,4-difluorocyclohexyl)-2-oxobutyl]benzoic acid (PubChem CID 160903604) has the molecular formula C29H25ClF5NO5 and a molecular weight of 597.96 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4,4-difluorocyclohexyl)-2-oxobutyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4,4-difluorocyclohexyl)-2-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 160903604 |
| Molecular Formula | C29H25ClF5NO5 |
| Molecular Weight | 597.96 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4,4-difluorocyclohexyl)-2-oxobutyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)C(CC2CCC(F)(F)CC2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C29H25ClF5NO5/c30-21-6-8-24(41-28(32)33)25(26(21)31)19-5-7-22(36(40)15-19)20(13-17-9-11-29(34,35)12-10-17)23(37)14-16-1-3-18(4-2-16)27(38)39/h1-8,15,17,20,28H,9-14H2,(H,38,39) |
| InChIKey | SPVKANOHJPSBSB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.96 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|