C27H23ClF3NO3 — CID 158362548
3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-1-[4-(1-hydroxyethenyl)phenyl]butan-2-one (PubChem CID 158362548) has the molecular formula C27H23ClF3NO3 and a molecular weight of 501.93 g/mol. Its IUPAC name is 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-1-[4-(1-hydroxyethenyl)phenyl]butan-2-one.
| Compound Name | 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-1-[4-(1-hydroxyethenyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 158362548 |
| Molecular Formula | C27H23ClF3NO3 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-1-[4-(1-hydroxyethenyl)phenyl]butan-2-one |
| SMILES | C=C(O)c1ccc(CC(=O)C(CC2CC2)c2ccc(-c3c(C(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C27H23ClF3NO3/c1-15(33)18-6-4-17(5-7-18)13-24(34)21(12-16-2-3-16)23-11-8-19(14-32(23)35)25-20(27(30)31)9-10-22(28)26(25)29/h4-11,14,16,21,27,33H,1-3,12-13H2 |
| InChIKey | OZWDNBHQBKSZCI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|