C29H27ClF3NO3 — CID 161182747
3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-(3-methylcyclobutyl)butan-2-one (PubChem CID 161182747) has the molecular formula C29H27ClF3NO3 and a molecular weight of 529.99 g/mol. Its IUPAC name is 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-(3-methylcyclobutyl)butan-2-one.
| Compound Name | 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-(3-methylcyclobutyl)butan-2-one |
|---|---|
| PubChem CID | 161182747 |
| Molecular Formula | C29H27ClF3NO3 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 3-[5-[3-chloro-6-(difluoromethyl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-1-[4-(1-hydroxyethenyl)phenyl]-4-(3-methylcyclobutyl)butan-2-one |
| SMILES | C=C(O)c1ccc(CC(=O)C(CC2CC(C)C2)c2ccc(-c3c(C(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C29H27ClF3NO3/c1-16-11-19(12-16)13-23(26(36)14-18-3-5-20(6-4-18)17(2)35)25-10-7-21(15-34(25)37)27-22(29(32)33)8-9-24(30)28(27)31/h3-10,15-16,19,23,29,35H,2,11-14H2,1H3 |
| InChIKey | MGASAESZKJYXFB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|