C26H23ClF3N2O5+ — CID 144970061
4-[[2-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid (PubChem CID 144970061) has the molecular formula C26H23ClF3N2O5+ and a molecular weight of 535.93 g/mol. Its IUPAC name is 4-[[2-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 144970061 |
| Molecular Formula | C26H23ClF3N2O5+ |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 4-[[2-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
| SMILES | CO[n+]1cc(-c2cc(Cl)ccc2OC(F)(F)F)ccc1C(CC1CC1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H22ClF3N2O5/c1-36-32-14-17(20-13-18(27)7-11-23(20)37-26(28,29)30)6-10-22(32)21(12-15-2-3-15)24(33)31-19-8-4-16(5-9-19)25(34)35/h4-11,13-15,21H,2-3,12H2,1H3,(H-,31,33,34,35)/p+1 |
| InChIKey | WNGLIDDLTVOMKM-UHFFFAOYSA-O |
| XLogP | 5.47 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|