C26H23ClN5O4+ — CID 144970070
4-[[2-[5-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid (PubChem CID 144970070) has the molecular formula C26H23ClN5O4+ and a molecular weight of 504.95 g/mol. Its IUPAC name is 4-[[2-[5-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 144970070 |
| Molecular Formula | C26H23ClN5O4+ |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-[[2-[5-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C(CC2CC2)c2ccc(-c3cc(Cl)ccc3-n3cncn3)c[n+]2O)cc1 |
| InChI | InChI=1S/C26H22ClN5O4/c27-19-6-10-23(31-15-28-14-29-31)21(12-19)18-5-9-24(32(36)13-18)22(11-16-1-2-16)25(33)30-20-7-3-17(4-8-20)26(34)35/h3-10,12-16,22H,1-2,11H2,(H2-,30,33,34,35,36)/p+1 |
| InChIKey | NJDQMZGWNZGZRF-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|