C26H28ClN4O4+ — CID 144970043
4-[[2-[5-(5-chloro-2-hydrazinylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid (PubChem CID 144970043) has the molecular formula C26H28ClN4O4+ and a molecular weight of 495.99 g/mol. Its IUPAC name is 4-[[2-[5-(5-chloro-2-hydrazinylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid.
| Compound Name | 4-[[2-[5-(5-chloro-2-hydrazinylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 144970043 |
| Molecular Formula | C26H28ClN4O4+ |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-[[2-[5-(5-chloro-2-hydrazinylphenyl)-1-methoxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]-2-methylbenzoic acid |
| SMILES | CO[n+]1cc(-c2cc(Cl)ccc2NN)ccc1C(CC1CC1)C(=O)Nc1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C26H27ClN4O4/c1-15-11-19(7-8-20(15)26(33)34)29-25(32)22(12-16-3-4-16)24-10-5-17(14-31(24)35-2)21-13-18(27)6-9-23(21)30-28/h5-11,13-14,16,22,30H,3-4,12,28H2,1-2H3,(H-,29,32,33,34)/p+1 |
| InChIKey | RLTSSTBGSLBUAG-UHFFFAOYSA-O |
| XLogP | 4.17 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|