C12H16O3 — CID 11854261
(2E,6E,8E,10E)-4-hydroxydodeca-2,6,8,10-tetraenoic acid (PubChem CID 11854261) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2E,6E,8E,10E)-4-hydroxydodeca-2,6,8,10-tetraenoic acid.
| Compound Name | (2E,6E,8E,10E)-4-hydroxydodeca-2,6,8,10-tetraenoic acid |
|---|---|
| PubChem CID | 11854261 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2E,6E,8E,10E)-4-hydroxydodeca-2,6,8,10-tetraenoic acid |
| SMILES | C/C=C/C=C/C=C/CC(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H16O3/c1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h2-7,9-11,13H,8H2,1H3,(H,14,15)/b3-2+,5-4+,7-6+,10-9+ |
| InChIKey | SUBHNPBCCHGRAZ-BIWCAXOLSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|