C18H22N4O2 — CID 118543276
5-amino-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide (PubChem CID 118543276) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-amino-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide.
| Compound Name | 5-amino-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118543276 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-amino-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide |
| SMILES | C=C1NC(=O)NC(C(=O)NC2CCC(c3ccccc3)CC2)=C1N |
| InChI | InChI=1S/C18H22N4O2/c1-11-15(19)16(22-18(24)20-11)17(23)21-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-6,13-14H,1,7-10,19H2,(H,21,23)(H2,20,22,24) |
| InChIKey | ZFNHFIFXAWDSQW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |