C26H36N4O2 — CID 118543439
5-[[(1S)-1-cyclohexylethyl]amino]-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide (PubChem CID 118543439) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 5-[[(1S)-1-cyclohexylethyl]amino]-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide.
| Compound Name | 5-[[(1S)-1-cyclohexylethyl]amino]-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118543439 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 5-[[(1S)-1-cyclohexylethyl]amino]-4-methylidene-2-oxo-N-(4-phenylcyclohexyl)-1H-pyrimidine-6-carboxamide |
| SMILES | C=C1NC(=O)NC(C(=O)NC2CCC(c3ccccc3)CC2)=C1N[C@@H](C)C1CCCCC1 |
| InChI | InChI=1S/C26H36N4O2/c1-17(19-9-5-3-6-10-19)27-23-18(2)28-26(32)30-24(23)25(31)29-22-15-13-21(14-16-22)20-11-7-4-8-12-20/h4,7-8,11-12,17,19,21-22,27H,2-3,5-6,9-10,13-16H2,1H3,(H,29,31)(H2,28,30,32)/t17-,21?,22?/m0/s1 |
| InChIKey | ALRJXUBXEUFSRW-YTXWROIDSA-N |
| XLogP | 4.43 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |