C26H33Cl2F3N4O5S — CID 118544952
4-[[1-(cyclohexylmethyl)-5-[2,3-dichloro-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]phenyl]pyrazole-3-carbonyl]amino]-2,2-dimethylbutanoic acid (PubChem CID 118544952) has the molecular formula C26H33Cl2F3N4O5S and a molecular weight of 641.54 g/mol. Its IUPAC name is 4-[[1-(cyclohexylmethyl)-5-[2,3-dichloro-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]phenyl]pyrazole-3-carbonyl]amino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[1-(cyclohexylmethyl)-5-[2,3-dichloro-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]phenyl]pyrazole-3-carbonyl]amino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 118544952 |
| Molecular Formula | C26H33Cl2F3N4O5S |
| Molecular Weight | 641.54 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 4-[[1-(cyclohexylmethyl)-5-[2,3-dichloro-4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]phenyl]pyrazole-3-carbonyl]amino]-2,2-dimethylbutanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(-c2cc(C(=O)NCCC(C)(C)C(=O)O)nn2CC2CCCCC2)c(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C26H33Cl2F3N4O5S/c1-15(26(29,30)31)34-41(39,40)20-10-9-17(21(27)22(20)28)19-13-18(23(36)32-12-11-25(2,3)24(37)38)33-35(19)14-16-7-5-4-6-8-16/h9-10,13,15-16,34H,4-8,11-12,14H2,1-3H3,(H,32,36)(H,37,38)/t15-/m0/s1 |
| InChIKey | IICMKIUIPCREGT-HNNXBMFYSA-N |
| XLogP | 5.90 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |