C30H33F3N4O5S2 — CID 121302077
3-[5-[4-(cyclohexylmethyl)-5-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 121302077) has the molecular formula C30H33F3N4O5S2 and a molecular weight of 650.75 g/mol. Its IUPAC name is 3-[5-[4-(cyclohexylmethyl)-5-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[5-[4-(cyclohexylmethyl)-5-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 121302077 |
| Molecular Formula | C30H33F3N4O5S2 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 3-[5-[4-(cyclohexylmethyl)-5-[4-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(-c2sc(-c3nnc(CC(C)(C)C(=O)O)o3)nc2CC2CCCCC2)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C30H33F3N4O5S2/c1-17(30(31,32)33)37-44(40,41)23-14-13-21(19-11-7-8-12-20(19)23)25-22(15-18-9-5-4-6-10-18)34-27(43-25)26-36-35-24(42-26)16-29(2,3)28(38)39/h7-8,11-14,17-18,37H,4-6,9-10,15-16H2,1-3H3,(H,38,39)/t17-/m0/s1 |
| InChIKey | STRUTJYZVVCYPT-KRWDZBQOSA-N |
| XLogP | 7.02 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |