C29H32F3N5O5S2 — CID 121311911
[1-[3-[4-(cyclohexylmethyl)-5-[8-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]isoquinolin-5-yl]-1,3-thiazol-2-yl]-1,2,4-oxadiazol-5-yl]-2-methylpropan-2-yl] formate (PubChem CID 121311911) has the molecular formula C29H32F3N5O5S2 and a molecular weight of 651.73 g/mol. Its IUPAC name is [1-[3-[4-(cyclohexylmethyl)-5-[8-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]isoquinolin-5-yl]-1,3-thiazol-2-yl]-1,2,4-oxadiazol-5-yl]-2-methylpropan-2-yl] formate.
| Compound Name | [1-[3-[4-(cyclohexylmethyl)-5-[8-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]isoquinolin-5-yl]-1,3-thiazol-2-yl]-1,2,4-oxadiazol-5-yl]-2-methylpropan-2-yl] formate |
|---|---|
| PubChem CID | 121311911 |
| Molecular Formula | C29H32F3N5O5S2 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | [1-[3-[4-(cyclohexylmethyl)-5-[8-[[(2S)-1,1,1-trifluoropropan-2-yl]sulfamoyl]isoquinolin-5-yl]-1,3-thiazol-2-yl]-1,2,4-oxadiazol-5-yl]-2-methylpropan-2-yl] formate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(-c2sc(-c3noc(CC(C)(C)OC=O)n3)nc2CC2CCCCC2)c2ccncc12)C(F)(F)F |
| InChI | InChI=1S/C29H32F3N5O5S2/c1-17(29(30,31)32)37-44(39,40)23-10-9-20(19-11-12-33-15-21(19)23)25-22(13-18-7-5-4-6-8-18)34-27(43-25)26-35-24(42-36-26)14-28(2,3)41-16-38/h9-12,15-18,37H,4-8,13-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | JZMTUUPNTYEHML-KRWDZBQOSA-N |
| XLogP | 6.25 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|