C26H31F3N4O5S2 — CID 121311795
[1-[5-[4-(cyclobutylmethyl)-5-[2-methyl-4-[[(2S)-1,1,1-trifluorobutan-2-yl]sulfamoyl]phenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2-methylpropan-2-yl] formate (PubChem CID 121311795) has the molecular formula C26H31F3N4O5S2 and a molecular weight of 600.69 g/mol. Its IUPAC name is [1-[5-[4-(cyclobutylmethyl)-5-[2-methyl-4-[[(2S)-1,1,1-trifluorobutan-2-yl]sulfamoyl]phenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2-methylpropan-2-yl] formate.
| Compound Name | [1-[5-[4-(cyclobutylmethyl)-5-[2-methyl-4-[[(2S)-1,1,1-trifluorobutan-2-yl]sulfamoyl]phenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2-methylpropan-2-yl] formate |
|---|---|
| PubChem CID | 121311795 |
| Molecular Formula | C26H31F3N4O5S2 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | [1-[5-[4-(cyclobutylmethyl)-5-[2-methyl-4-[[(2S)-1,1,1-trifluorobutan-2-yl]sulfamoyl]phenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2-methylpropan-2-yl] formate |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc(-c2sc(-c3nnc(CC(C)(C)OC=O)o3)nc2CC2CCC2)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O5S2/c1-5-20(26(27,28)29)33-40(35,36)17-9-10-18(15(2)11-17)22-19(12-16-7-6-8-16)30-24(39-22)23-32-31-21(38-23)13-25(3,4)37-14-34/h9-11,14,16,20,33H,5-8,12-13H2,1-4H3/t20-/m0/s1 |
| InChIKey | CRAXVXXCCSEAJR-FQEVSTJZSA-N |
| XLogP | 5.62 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|