C25H26F6N4O3S2 — CID 163463002
3-[5-[4-(cyclobutylmethyl)-5-[2-(trifluoromethyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]sulfanylphenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 163463002) has the molecular formula C25H26F6N4O3S2 and a molecular weight of 608.63 g/mol. Its IUPAC name is 3-[5-[4-(cyclobutylmethyl)-5-[2-(trifluoromethyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]sulfanylphenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[5-[4-(cyclobutylmethyl)-5-[2-(trifluoromethyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]sulfanylphenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 163463002 |
| Molecular Formula | C25H26F6N4O3S2 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 3-[5-[4-(cyclobutylmethyl)-5-[2-(trifluoromethyl)-4-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]sulfanylphenyl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | C[C@H](NSc1ccc(-c2sc(-c3nnc(CC(C)(C)C(=O)O)o3)nc2CC2CCC2)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H26F6N4O3S2/c1-12(24(26,27)28)35-40-14-7-8-15(16(10-14)25(29,30)31)19-17(9-13-5-4-6-13)32-21(39-19)20-34-33-18(38-20)11-23(2,3)22(36)37/h7-8,10,12-13,35H,4-6,9,11H2,1-3H3,(H,36,37)/t12-/m0/s1 |
| InChIKey | BQFCQDGCKBDWBB-LBPRGKRZSA-N |
| XLogP | 7.42 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|