C33H40N4O4S — CID 121311792
3-[5-[4-(cyclobutylmethyl)-5-[4-[(1S)-1-(3,3-dimethylmorpholin-4-yl)ethyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 121311792) has the molecular formula C33H40N4O4S and a molecular weight of 588.77 g/mol. Its IUPAC name is 3-[5-[4-(cyclobutylmethyl)-5-[4-[(1S)-1-(3,3-dimethylmorpholin-4-yl)ethyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[5-[4-(cyclobutylmethyl)-5-[4-[(1S)-1-(3,3-dimethylmorpholin-4-yl)ethyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 121311792 |
| Molecular Formula | C33H40N4O4S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 3-[5-[4-(cyclobutylmethyl)-5-[4-[(1S)-1-(3,3-dimethylmorpholin-4-yl)ethyl]naphthalen-1-yl]-1,3-thiazol-2-yl]-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | C[C@@H](c1ccc(-c2sc(-c3nnc(CC(C)(C)C(=O)O)o3)nc2CC2CCC2)c2ccccc12)N1CCOCC1(C)C |
| InChI | InChI=1S/C33H40N4O4S/c1-20(37-15-16-40-19-33(37,4)5)22-13-14-25(24-12-7-6-11-23(22)24)28-26(17-21-9-8-10-21)34-30(42-28)29-36-35-27(41-29)18-32(2,3)31(38)39/h6-7,11-14,20-21H,8-10,15-19H2,1-5H3,(H,38,39)/t20-/m0/s1 |
| InChIKey | OTZJTJRGEPMBCH-FQEVSTJZSA-N |
| XLogP | 7.18 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |