C18H18O3 — CID 118548809
3-(4-ethynyl-2-methoxy-6-methylphenyl)bicyclo[3.2.1]octane-2,4-dione (PubChem CID 118548809) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(4-ethynyl-2-methoxy-6-methylphenyl)bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(4-ethynyl-2-methoxy-6-methylphenyl)bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 118548809 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(4-ethynyl-2-methoxy-6-methylphenyl)bicyclo[3.2.1]octane-2,4-dione |
| SMILES | C#Cc1cc(C)c(C2C(=O)C3CCC(C3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H18O3/c1-4-11-7-10(2)15(14(8-11)21-3)16-17(19)12-5-6-13(9-12)18(16)20/h1,7-8,12-13,16H,5-6,9H2,2-3H3 |
| InChIKey | MSIOVLOSNVBFEL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|