C27H35NO4 — CID 155591938
5-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione (PubChem CID 155591938) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 155591938 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C3CCN(C(=O)C(C)(C)C)CC3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C27H35NO4/c1-7-8-18-13-17(2)24(23(14-18)32-6)25-21(29)15-20(16-22(25)30)19-9-11-28(12-10-19)26(31)27(3,4)5/h13-14,19-20,25H,9-12,15-16H2,1-6H3 |
| InChIKey | ATDDAIQKEMALAX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|