C21H22ClNO4 — CID 155592084
2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-5-(pyrrolidine-1-carbonyl)cyclohexane-1,3-dione (PubChem CID 155592084) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-5-(pyrrolidine-1-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-5-(pyrrolidine-1-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 155592084 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-5-(pyrrolidine-1-carbonyl)cyclohexane-1,3-dione |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)CC(C(=O)N3CCCC3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C21H22ClNO4/c1-3-6-13-9-15(22)19(18(10-13)27-2)20-16(24)11-14(12-17(20)25)21(26)23-7-4-5-8-23/h9-10,14,20H,4-5,7-8,11-12H2,1-2H3 |
| InChIKey | DZSNWMKAFWUQFN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|