C21H24ClNO4 — CID 155591927
4-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 155591927) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is 4-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155591927 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)CC(C(=O)N(C)C(C)C)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-6-7-13-8-15(22)19(18(9-13)27-5)20-16(24)10-14(11-17(20)25)21(26)23(4)12(2)3/h8-9,12,14,20H,10-11H2,1-5H3 |
| InChIKey | SFLVXDWCEMUQDH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|