C24H30ClNO2 — CID 155591939
5-[1-[tert-butyl(methyl)amino]ethenyl]-2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-methylidenecyclohexan-1-one (PubChem CID 155591939) has the molecular formula C24H30ClNO2 and a molecular weight of 399.96 g/mol. Its IUPAC name is 5-[1-[tert-butyl(methyl)amino]ethenyl]-2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-methylidenecyclohexan-1-one.
| Compound Name | 5-[1-[tert-butyl(methyl)amino]ethenyl]-2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-methylidenecyclohexan-1-one |
|---|---|
| PubChem CID | 155591939 |
| Molecular Formula | C24H30ClNO2 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 5-[1-[tert-butyl(methyl)amino]ethenyl]-2-(2-chloro-6-methoxy-4-prop-1-ynylphenyl)-3-methylidenecyclohexan-1-one |
| SMILES | C=C1CC(C(=C)N(C)C(C)(C)C)CC(=O)C1c1c(Cl)cc(C#CC)cc1OC |
| InChI | InChI=1S/C24H30ClNO2/c1-9-10-17-12-19(25)23(21(13-17)28-8)22-15(2)11-18(14-20(22)27)16(3)26(7)24(4,5)6/h12-13,18,22H,2-3,11,14H2,1,4-8H3 |
| InChIKey | KAAMGDHILDVCJM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|