C16H16O3 — CID 129303397
2-(2-methoxy-4-prop-1-ynylphenyl)cyclohexane-1,3-dione (PubChem CID 129303397) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-1-ynylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2-methoxy-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 129303397 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(2-methoxy-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
| SMILES | CC#Cc1ccc(C2C(=O)CCCC2=O)c(OC)c1 |
| InChI | InChI=1S/C16H16O3/c1-3-5-11-8-9-12(15(10-11)19-2)16-13(17)6-4-7-14(16)18/h8-10,16H,4,6-7H2,1-2H3 |
| InChIKey | LSAIRFOJWVDIMN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|