C20H20O4 — CID 142381985
(1R,2S,6R)-4-(2-methoxy-4-prop-1-ynylphenyl)-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142381985) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1R,2S,6R)-4-(2-methoxy-4-prop-1-ynylphenyl)-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R)-4-(2-methoxy-4-prop-1-ynylphenyl)-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142381985 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1R,2S,6R)-4-(2-methoxy-4-prop-1-ynylphenyl)-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC#Cc1ccc(C2C(=O)[C@H]3C4CC[C@@](C)(O4)[C@H]3C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H20O4/c1-4-5-11-6-7-12(14(10-11)23-3)15-18(21)16-13-8-9-20(2,24-13)17(16)19(15)22/h6-7,10,13,15-17H,8-9H2,1-3H3/t13?,15?,16-,17+,20+/m0/s1 |
| InChIKey | DBTISCKGHVSRDL-SWENHXOTSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|