C20H20O5 — CID 146552383
(1S,2R,6S,7R,8R)-8-(hydroxymethyl)-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 146552383) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1S,2R,6S,7R,8R)-8-(hydroxymethyl)-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8R)-8-(hydroxymethyl)-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 146552383 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1S,2R,6S,7R,8R)-8-(hydroxymethyl)-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC#Cc1ccc(C2C(=O)[C@@H]3[C@@H]4O[C@@H](C[C@@H]4CO)[C@@H]3C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H20O5/c1-3-4-10-5-6-12(13(7-10)24-2)15-18(22)16-14-8-11(9-21)20(25-14)17(16)19(15)23/h5-7,11,14-17,20-21H,8-9H2,1-2H3/t11-,14+,15?,16+,17-,20-/m1/s1 |
| InChIKey | ZEWVPRPSTKYJTK-KWGZMELYSA-N |
| XLogP | 1.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|