C19H23BrO4 — CID 142382005
bromomethane;(2R,6S)-8-ethyl-4-(2-methoxyphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142382005) has the molecular formula C19H23BrO4 and a molecular weight of 395.29 g/mol. Its IUPAC name is bromomethane;(2R,6S)-8-ethyl-4-(2-methoxyphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | bromomethane;(2R,6S)-8-ethyl-4-(2-methoxyphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142382005 |
| Molecular Formula | C19H23BrO4 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | bromomethane;(2R,6S)-8-ethyl-4-(2-methoxyphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CBr.CCC1CC2OC1[C@H]1C(=O)C(c3ccccc3OC)C(=O)[C@@H]21 |
| InChI | InChI=1S/C18H20O4.CH3Br/c1-3-9-8-12-14-15(18(9)22-12)17(20)13(16(14)19)10-6-4-5-7-11(10)21-2;1-2/h4-7,9,12-15,18H,3,8H2,1-2H3;1H3/t9?,12?,13?,14-,15+,18?;/m0./s1 |
| InChIKey | ZEABAKYQNZDQPN-INJTXXBDSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|