C21H22O4 — CID 142381988
(2R,6S,8S)-8-ethyl-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142381988) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2R,6S,8S)-8-ethyl-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S,8S)-8-ethyl-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142381988 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2R,6S,8S)-8-ethyl-4-(2-methoxy-4-prop-1-ynylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC#Cc1ccc(C2C(=O)[C@@H]3C4OC(C[C@@H]4CC)[C@@H]3C2=O)c(OC)c1 |
| InChI | InChI=1S/C21H22O4/c1-4-6-11-7-8-13(14(9-11)24-3)16-19(22)17-15-10-12(5-2)21(25-15)18(17)20(16)23/h7-9,12,15-18,21H,5,10H2,1-3H3/t12-,15?,16?,17-,18+,21?/m0/s1 |
| InChIKey | YUNPRUZAMXAOFD-OPDQSYAYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|