C23H24O5 — CID 135170413
[(6S)-4-(2-methoxy-4-prop-1-ynylphenyl)-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2-methylpropanoate (PubChem CID 135170413) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(6S)-4-(2-methoxy-4-prop-1-ynylphenyl)-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2-methylpropanoate.
| Compound Name | [(6S)-4-(2-methoxy-4-prop-1-ynylphenyl)-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 135170413 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(6S)-4-(2-methoxy-4-prop-1-ynylphenyl)-5-oxo-10-oxatricyclo[5.2.1.02,6]dec-3-en-3-yl] 2-methylpropanoate |
| SMILES | CC#Cc1ccc(C2=C(OC(=O)C(C)C)C3C4CCC(O4)[C@H]3C2=O)c(OC)c1 |
| InChI | InChI=1S/C23H24O5/c1-5-6-13-7-8-14(17(11-13)26-4)18-21(24)19-15-9-10-16(27-15)20(19)22(18)28-23(25)12(2)3/h7-8,11-12,15-16,19-20H,9-10H2,1-4H3/t15?,16?,19-,20?/m1/s1 |
| InChIKey | KDZJUYBJDIQASM-VYJHHOQDSA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|