C21H24O — CID 166463476
1-(2-ethenyl-3-ethyl-6-methylidenecyclohexen-1-yl)-2-methoxy-4-prop-1-ynylbenzene (PubChem CID 166463476) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(2-ethenyl-3-ethyl-6-methylidenecyclohexen-1-yl)-2-methoxy-4-prop-1-ynylbenzene.
| Compound Name | 1-(2-ethenyl-3-ethyl-6-methylidenecyclohexen-1-yl)-2-methoxy-4-prop-1-ynylbenzene |
|---|---|
| PubChem CID | 166463476 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-(2-ethenyl-3-ethyl-6-methylidenecyclohexen-1-yl)-2-methoxy-4-prop-1-ynylbenzene |
| SMILES | C=CC1=C(c2ccc(C#CC)cc2OC)C(=C)CCC1CC |
| InChI | InChI=1S/C21H24O/c1-6-9-16-11-13-19(20(14-16)22-5)21-15(4)10-12-17(7-2)18(21)8-3/h8,11,13-14,17H,3-4,7,10,12H2,1-2,5H3 |
| InChIKey | ZTFBFBQJYQXEJK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|