C9H10N2 — CID 129073415
4-prop-1-ynylbenzene-1,2-diamine (PubChem CID 129073415) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-prop-1-ynylbenzene-1,2-diamine.
| Compound Name | 4-prop-1-ynylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 129073415 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-prop-1-ynylbenzene-1,2-diamine |
| SMILES | CC#Cc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H10N2/c1-2-3-7-4-5-8(10)9(11)6-7/h4-6H,10-11H2,1H3 |
| InChIKey | LXCHBPYHHHMXNN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|