C18H16N2 — CID 139881243
5-[4-(3-amino-4-methylphenyl)buta-1,3-diynyl]-2-methylaniline (PubChem CID 139881243) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-[4-(3-amino-4-methylphenyl)buta-1,3-diynyl]-2-methylaniline.
| Compound Name | 5-[4-(3-amino-4-methylphenyl)buta-1,3-diynyl]-2-methylaniline |
|---|---|
| PubChem CID | 139881243 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-[4-(3-amino-4-methylphenyl)buta-1,3-diynyl]-2-methylaniline |
| SMILES | Cc1ccc(C#CC#Cc2ccc(C)c(N)c2)cc1N |
| InChI | InChI=1S/C18H16N2/c1-13-7-9-15(11-17(13)19)5-3-4-6-16-10-8-14(2)18(20)12-16/h7-12H,19-20H2,1-2H3 |
| InChIKey | WMJYAZQYXUXKFE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|