C19H23NO4S — CID 91347181
2-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]cyclohexane-1,3-dione (PubChem CID 91347181) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]cyclohexane-1,3-dione.
| Compound Name | 2-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 91347181 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]cyclohexane-1,3-dione |
| SMILES | COc1ccc(C2CC(C3C(=O)CCCC3=O)=NCCS2)c(OC)c1 |
| InChI | InChI=1S/C19H23NO4S/c1-23-12-6-7-13(17(10-12)24-2)18-11-14(20-8-9-25-18)19-15(21)4-3-5-16(19)22/h6-7,10,18-19H,3-5,8-9,11H2,1-2H3 |
| InChIKey | JAGOWPMPYPXCCE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|