C25H31NO3 — CID 155591931
N-[4-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]cyclohexyl]acetamide (PubChem CID 155591931) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[4-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]cyclohexyl]acetamide.
| Compound Name | N-[4-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 155591931 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[4-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]cyclohexyl]acetamide |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C3CCC(NC(C)=O)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C25H31NO3/c1-5-6-18-11-15(2)24(16(3)12-18)25-22(28)13-20(14-23(25)29)19-7-9-21(10-8-19)26-17(4)27/h11-12,19-21,25H,7-10,13-14H2,1-4H3,(H,26,27) |
| InChIKey | YMINOSKMDCMVEK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|