C24H29NO3 — CID 155592082
3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]-N-methylcyclopentane-1-carboxamide (PubChem CID 155592082) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]-N-methylcyclopentane-1-carboxamide.
| Compound Name | 3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155592082 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]-N-methylcyclopentane-1-carboxamide |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C3CCC(C(=O)NC)C3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H29NO3/c1-5-6-16-9-14(2)22(15(3)10-16)23-20(26)12-19(13-21(23)27)17-7-8-18(11-17)24(28)25-4/h9-10,17-19,23H,7-8,11-13H2,1-4H3,(H,25,28) |
| InChIKey | HRMDBMCBHCRBIK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|