C26H32N2O3 — CID 139477626
3-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139477626) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139477626 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 3-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C4=NOC(C)(C)C4)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C26H32N2O3/c1-6-7-19-12-17(2)23(18(3)13-19)24-20(29)14-26(15-21(24)30)8-10-28(11-9-26)22-16-25(4,5)31-27-22/h12-13,24H,8-11,14-16H2,1-5H3 |
| InChIKey | IXJAXGYQRIVZBN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|